C22H37NO6S — CID 5002481
[5-[[decanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 5002481) has the molecular formula C22H37NO6S and a molecular weight of 443.61 g/mol. Its IUPAC name is [5-[[decanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[decanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 5002481 |
| Molecular Formula | C22H37NO6S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [5-[[decanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | CCCCCCCCCC(=O)N(CCOC)Cc1ccc(OC)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H37NO6S/c1-5-6-7-8-9-10-11-12-22(24)23(15-16-27-2)18-19-13-14-20(28-3)21(17-19)29-30(4,25)26/h13-14,17H,5-12,15-16,18H2,1-4H3 |
| InChIKey | HJMJDXXMBYZGRJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|