C27H36F3NO3 — CID 4235664
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]nonanamide (PubChem CID 4235664) has the molecular formula C27H36F3NO3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]nonanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 4235664 |
| Molecular Formula | C27H36F3NO3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H36F3NO3/c1-4-5-6-7-8-9-10-26(32)31(20-22-11-14-23(15-12-22)27(28,29)30)18-17-21-13-16-24(33-2)25(19-21)34-3/h11-16,19H,4-10,17-18,20H2,1-3H3 |
| InChIKey | QPIRSUXQGFQGHV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|