C21H30N2O3S — CID 5094204
6-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-3-ylmethyl)hexanamide (PubChem CID 5094204) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is 6-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-3-ylmethyl)hexanamide.
| Compound Name | 6-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-3-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 5094204 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 6-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(thiophen-3-ylmethyl)hexanamide |
| SMILES | COc1ccc(CCN(Cc2ccsc2)C(=O)CCCCCN)cc1OC |
| InChI | InChI=1S/C21H30N2O3S/c1-25-19-8-7-17(14-20(19)26-2)9-12-23(15-18-10-13-27-16-18)21(24)6-4-3-5-11-22/h7-8,10,13-14,16H,3-6,9,11-12,15,22H2,1-2H3 |
| InChIKey | QZGKIDRCPCSCCA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|