C28H39NO3 — CID 4694083
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide (PubChem CID 4694083) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide |
|---|---|
| PubChem CID | 4694083 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCc1ccc(OC)c(OC)c1)CC(C)=Cc1ccccc1 |
| InChI | InChI=1S/C28H39NO3/c1-5-6-7-8-12-15-28(30)29(22-23(2)20-24-13-10-9-11-14-24)19-18-25-16-17-26(31-3)27(21-25)32-4/h9-11,13-14,16-17,20-21H,5-8,12,15,18-19,22H2,1-4H3 |
| InChIKey | OMQRESKCMNARQQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|