C28H31N5O3 — CID 21295539
N-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1-phenyltetrazol-5-yl)butanamide (PubChem CID 21295539) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1-phenyltetrazol-5-yl)butanamide.
| Compound Name | N-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1-phenyltetrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 21295539 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(1-phenyltetrazol-5-yl)butanamide |
| SMILES | COc1ccc(CCN(Cc2ccccc2)C(=O)CCCc2nnnn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H31N5O3/c1-35-25-17-16-22(20-26(25)36-2)18-19-32(21-23-10-5-3-6-11-23)28(34)15-9-14-27-29-30-31-33(27)24-12-7-4-8-13-24/h3-8,10-13,16-17,20H,9,14-15,18-19,21H2,1-2H3 |
| InChIKey | NIRUSOFQVVMYLP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |