C17H18FN5O — CID 18088323
1-(3-fluoro-4-methoxyphenyl)-N-methyl-N-[(1-phenyltetrazol-5-yl)methyl]methanamine (PubChem CID 18088323) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-N-methyl-N-[(1-phenyltetrazol-5-yl)methyl]methanamine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-N-methyl-N-[(1-phenyltetrazol-5-yl)methyl]methanamine |
|---|---|
| PubChem CID | 18088323 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-N-methyl-N-[(1-phenyltetrazol-5-yl)methyl]methanamine |
| SMILES | COc1ccc(CN(C)Cc2nnnn2-c2ccccc2)cc1F |
| InChI | InChI=1S/C17H18FN5O/c1-22(11-13-8-9-16(24-2)15(18)10-13)12-17-19-20-21-23(17)14-6-4-3-5-7-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | ILIAXFNIHBGUGQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |