C22H31NO3Si — CID 10620133
N-[3-(3,4-dimethoxyphenyl)propyl]-N-(trimethylsilylmethyl)benzamide (PubChem CID 10620133) has the molecular formula C22H31NO3Si and a molecular weight of 385.58 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-N-(trimethylsilylmethyl)benzamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N-(trimethylsilylmethyl)benzamide |
|---|---|
| PubChem CID | 10620133 |
| Molecular Formula | C22H31NO3Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N-(trimethylsilylmethyl)benzamide |
| SMILES | COc1ccc(CCCN(C[Si](C)(C)C)C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H31NO3Si/c1-25-20-14-13-18(16-21(20)26-2)10-9-15-23(17-27(3,4)5)22(24)19-11-7-6-8-12-19/h6-8,11-14,16H,9-10,15,17H2,1-5H3 |
| InChIKey | LIXDSGBDEQTEIR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|