C20H22N2O3 — CID 38713614
3-cyano-N-[3-(3,4-dimethoxyphenyl)propyl]-N-methylbenzamide (PubChem CID 38713614) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-cyano-N-[3-(3,4-dimethoxyphenyl)propyl]-N-methylbenzamide.
| Compound Name | 3-cyano-N-[3-(3,4-dimethoxyphenyl)propyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 38713614 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-cyano-N-[3-(3,4-dimethoxyphenyl)propyl]-N-methylbenzamide |
| SMILES | COc1ccc(CCCN(C)C(=O)c2cccc(C#N)c2)cc1OC |
| InChI | InChI=1S/C20H22N2O3/c1-22(20(23)17-8-4-6-16(12-17)14-21)11-5-7-15-9-10-18(24-2)19(13-15)25-3/h4,6,8-10,12-13H,5,7,11H2,1-3H3 |
| InChIKey | YBXZVWHHONEEIO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |