C25H26O6 — CID 171345656
[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] benzoate (PubChem CID 171345656) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] benzoate.
| Compound Name | [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 171345656 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] benzoate |
| SMILES | COc1ccc(CCc2cc(OC)c(OC(=O)c3ccccc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H26O6/c1-27-20-13-12-17(14-21(20)28-2)10-11-18-15-22(29-3)24(23(16-18)30-4)31-25(26)19-8-6-5-7-9-19/h5-9,12-16H,10-11H2,1-4H3 |
| InChIKey | YUPFXVTTZYCHQF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|