C24H26N2O6 — CID 175177068
[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-methylpyrimidine-5-carboxylate (PubChem CID 175177068) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-methylpyrimidine-5-carboxylate.
| Compound Name | [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 175177068 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] 2-methylpyrimidine-5-carboxylate |
| SMILES | COc1ccc(CCc2cc(OC)c(OC)c(OC)c2)cc1OC(=O)c1cnc(C)nc1 |
| InChI | InChI=1S/C24H26N2O6/c1-15-25-13-18(14-26-15)24(27)32-20-10-16(8-9-19(20)28-2)6-7-17-11-21(29-3)23(31-5)22(12-17)30-4/h8-14H,6-7H2,1-5H3 |
| InChIKey | QZGWZVYSHFOYCS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|