3-(3,4-dibenzoyloxyphenyl)propanoic acid

C23H18O6 — CID 19097459

IUPAC3-(3,4-dibenzoyloxyphenyl)propanoic acid
SMILESO=C(O)CCc1ccc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c1
InChIInChI=1S/C23H18O6/c24-21(25)14-12-16-11-13-19(28-22(26)17-7-3-1-4-8-17)20(15-16)29-23(27)18-9-5-2-6-10-18/h1-11,13,15H,12,14H2,(H,24,25)
InChIKeyJAQCDXSAAMVJCZ-UHFFFAOYSA-N
MW390.39 g/mol
LogP4.14
Rot. Bonds7

About 3-(3,4-dibenzoyloxyphenyl)propanoic acid

3-(3,4-dibenzoyloxyphenyl)propanoic acid (PubChem CID 19097459) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-(3,4-dibenzoyloxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(3,4-dibenzoyloxyphenyl)propanoic acid
PubChem CID19097459
Molecular FormulaC23H18O6
Molecular Weight390.39 g/mol
Exact Mass390.11
IUPAC Name3-(3,4-dibenzoyloxyphenyl)propanoic acid
SMILESO=C(O)CCc1ccc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c1
InChIInChI=1S/C23H18O6/c24-21(25)14-12-16-11-13-19(28-22(26)17-7-3-1-4-8-17)20(15-16)29-23(27)18-9-5-2-6-10-18/h1-11,13,15H,12,14H2,(H,24,25)
InChIKeyJAQCDXSAAMVJCZ-UHFFFAOYSA-N
XLogP4.14
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms29
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500390.39
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 3-(3,4-dibenzoyloxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dibenzoyloxyphenyl)propanoic acid?
The IUPAC name of 3-(3,4-dibenzoyloxyphenyl)propanoic acid (CID 19097459) is 3-(3,4-dibenzoyloxyphenyl)propanoic acid.
What is the SMILES notation for 3-(3,4-dibenzoyloxyphenyl)propanoic acid?
The canonical SMILES for 3-(3,4-dibenzoyloxyphenyl)propanoic acid is O=C(O)CCc1ccc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c1.
What is the InChIKey of 3-(3,4-dibenzoyloxyphenyl)propanoic acid?
The InChIKey is JAQCDXSAAMVJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18O6/c24-21(25)14-12-16-11-13-19(28-22(26)17-7-3-1-4-8-17)20(15-16)29-23(27)18-9-5-2-6-10-18/h1-11,13,15H,12,14H2,(H,24,25).
What are the key properties of 3-(3,4-dibenzoyloxyphenyl)propanoic acid?
3-(3,4-dibenzoyloxyphenyl)propanoic acid has a molecular weight of 390.39 g/mol, XLogP of 4.14, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dibenzoyloxyphenyl)propanoic acid is sourced from PubChem (CID 19097459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).