3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid

C15H22O4 — CID 82050366

IUPAC3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid
SMILESCC(C)Oc1ccc(CCC(=O)O)cc1OC(C)C
InChIInChI=1S/C15H22O4/c1-10(2)18-13-7-5-12(6-8-15(16)17)9-14(13)19-11(3)4/h5,7,9-11H,6,8H2,1-4H3,(H,16,17)
InChIKeySHHWELOZFIWBFF-UHFFFAOYSA-N
MW266.34 g/mol
LogP3.28
Rot. Bonds7

About 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid

3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid (PubChem CID 82050366) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid.

Molecular Properties

Compound Name3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid
PubChem CID82050366
Molecular FormulaC15H22O4
Molecular Weight266.34 g/mol
Exact Mass266.15
IUPAC Name3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid
SMILESCC(C)Oc1ccc(CCC(=O)O)cc1OC(C)C
InChIInChI=1S/C15H22O4/c1-10(2)18-13-7-5-12(6-8-15(16)17)9-14(13)19-11(3)4/h5,7,9-11H,6,8H2,1-4H3,(H,16,17)
InChIKeySHHWELOZFIWBFF-UHFFFAOYSA-N
XLogP3.28
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid?
The IUPAC name of 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid (CID 82050366) is 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid.
What is the SMILES notation for 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid?
The canonical SMILES for 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid is CC(C)Oc1ccc(CCC(=O)O)cc1OC(C)C.
What is the InChIKey of 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid?
The InChIKey is SHHWELOZFIWBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-10(2)18-13-7-5-12(6-8-15(16)17)9-14(13)19-11(3)4/h5,7,9-11H,6,8H2,1-4H3,(H,16,17).
What are the key properties of 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid?
3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid has a molecular weight of 266.34 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-di(propan-2-yloxy)phenyl]propanoic acid is sourced from PubChem (CID 82050366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).