C17H26O3 — CID 82554235
methyl 3-(3-tert-butyl-4-propan-2-yloxyphenyl)propanoate (PubChem CID 82554235) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 3-(3-tert-butyl-4-propan-2-yloxyphenyl)propanoate.
| Compound Name | methyl 3-(3-tert-butyl-4-propan-2-yloxyphenyl)propanoate |
|---|---|
| PubChem CID | 82554235 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 3-(3-tert-butyl-4-propan-2-yloxyphenyl)propanoate |
| SMILES | COC(=O)CCc1ccc(OC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-12(2)20-15-9-7-13(8-10-16(18)19-6)11-14(15)17(3,4)5/h7,9,11-12H,8,10H2,1-6H3 |
| InChIKey | PUDJJQJWHIBBPV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |