C35H40N2O10 — CID 23387524
3-[3,4-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]phenyl]propanoic acid (PubChem CID 23387524) has the molecular formula C35H40N2O10 and a molecular weight of 648.71 g/mol. Its IUPAC name is 3-[3,4-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]phenyl]propanoic acid.
| Compound Name | 3-[3,4-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23387524 |
| Molecular Formula | C35H40N2O10 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 3-[3,4-bis[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxy]phenyl]propanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc(CCC(=O)O)cc1OC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C35H40N2O10/c1-22(2)30(36-34(42)44-20-25-11-7-5-8-12-25)32(40)46-27-17-15-24(16-18-29(38)39)19-28(27)47-33(41)31(23(3)4)37-35(43)45-21-26-13-9-6-10-14-26/h5-15,17,19,22-23,30-31H,16,18,20-21H2,1-4H3,(H,36,42)(H,37,43)(H,38,39)/t30-,31-/m0/s1 |
| InChIKey | BAAACCCPZXASMA-CONSDPRKSA-N |
| XLogP | 5.42 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|