C36H39IN2O11 — CID 139931593
[4-[2-hydroxy-3-(iodomethoxy)-3-oxoprop-1-enyl]-2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyphenyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 139931593) has the molecular formula C36H39IN2O11 and a molecular weight of 802.61 g/mol. Its IUPAC name is [4-[2-hydroxy-3-(iodomethoxy)-3-oxoprop-1-enyl]-2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyphenyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [4-[2-hydroxy-3-(iodomethoxy)-3-oxoprop-1-enyl]-2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyphenyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 139931593 |
| Molecular Formula | C36H39IN2O11 |
| Molecular Weight | 802.61 g/mol |
| Exact Mass | 802.16 |
| IUPAC Name | [4-[2-hydroxy-3-(iodomethoxy)-3-oxoprop-1-enyl]-2-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]oxyphenyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc(C=C(O)C(=O)OCI)cc1OC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C36H39IN2O11/c1-22(2)30(38-35(44)46-19-24-11-7-5-8-12-24)33(42)49-28-16-15-26(17-27(40)32(41)48-21-37)18-29(28)50-34(43)31(23(3)4)39-36(45)47-20-25-13-9-6-10-14-25/h5-18,22-23,30-31,40H,19-21H2,1-4H3,(H,38,44)(H,39,45)/t30-,31-/m0/s1 |
| InChIKey | PLMRSFBXEUZOSS-CONSDPRKSA-N |
| XLogP | 6.23 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|