C20H21NO7 — CID 139931558
(3-carboxyoxyphenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 139931558) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is (3-carboxyoxyphenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (3-carboxyoxyphenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 139931558 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (3-carboxyoxyphenyl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1cccc(OC(=O)O)c1 |
| InChI | InChI=1S/C20H21NO7/c1-13(2)17(21-19(23)26-12-14-7-4-3-5-8-14)18(22)27-15-9-6-10-16(11-15)28-20(24)25/h3-11,13,17H,12H2,1-2H3,(H,21,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | GIRJZQNAELRODS-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|