C26H26N2O4 — CID 122675562
(8-methyl-9H-carbazol-2-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 122675562) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is (8-methyl-9H-carbazol-2-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (8-methyl-9H-carbazol-2-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 122675562 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (8-methyl-9H-carbazol-2-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | Cc1cccc2c1[nH]c1cc(OC(=O)[C@@H](NC(=O)OCc3ccccc3)C(C)C)ccc12 |
| InChI | InChI=1S/C26H26N2O4/c1-16(2)23(28-26(30)31-15-18-9-5-4-6-10-18)25(29)32-19-12-13-20-21-11-7-8-17(3)24(21)27-22(20)14-19/h4-14,16,23,27H,15H2,1-3H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | DWSRVTLROVTYKC-QHCPKHFHSA-N |
| XLogP | 5.49 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|