C32H34O8 — CID 162094222
[4-[4-ethoxycarbonyl-7-(3-methoxy-4-methylphenyl)-3,5-dioxoheptyl]-2-methoxyphenyl] benzoate (PubChem CID 162094222) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is [4-[4-ethoxycarbonyl-7-(3-methoxy-4-methylphenyl)-3,5-dioxoheptyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[4-ethoxycarbonyl-7-(3-methoxy-4-methylphenyl)-3,5-dioxoheptyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 162094222 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [4-[4-ethoxycarbonyl-7-(3-methoxy-4-methylphenyl)-3,5-dioxoheptyl]-2-methoxyphenyl] benzoate |
| SMILES | CCOC(=O)C(C(=O)CCc1ccc(C)c(OC)c1)C(=O)CCc1ccc(OC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H34O8/c1-5-39-32(36)30(25(33)16-13-22-12-11-21(2)28(19-22)37-3)26(34)17-14-23-15-18-27(29(20-23)38-4)40-31(35)24-9-7-6-8-10-24/h6-12,15,18-20,30H,5,13-14,16-17H2,1-4H3 |
| InChIKey | MFRUSWBGIWKYIO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|