C20H25NO3 — CID 78808087
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-3-phenylpropanamide (PubChem CID 78808087) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-3-phenylpropanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 78808087 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-3-phenylpropanamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H25NO3/c1-4-21(20(22)13-11-16-8-6-5-7-9-16)15-17-10-12-18(23-2)19(14-17)24-3/h5-10,12,14H,4,11,13,15H2,1-3H3 |
| InChIKey | IAFBWIZIVSXTOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |