C26H28N2O5 — CID 27876771
2-[2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 27876771) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 27876771 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)C(=O)COc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H28N2O5/c1-4-28(17-19-14-15-23(31-2)24(16-19)32-3)25(29)18-33-22-13-9-8-12-21(22)26(30)27-20-10-6-5-7-11-20/h5-16H,4,17-18H2,1-3H3,(H,27,30) |
| InChIKey | HGBJDAGNMLEKEX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |