C33H51N3O6 — CID 3941830
N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)nonanamide (PubChem CID 3941830) has the molecular formula C33H51N3O6 and a molecular weight of 585.79 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)nonanamide.
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)nonanamide |
|---|---|
| PubChem CID | 3941830 |
| Molecular Formula | C33H51N3O6 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCN1CCOCC1)CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccco1 |
| InChI | InChI=1S/C33H51N3O6/c1-4-5-6-7-8-9-13-32(37)35(18-11-17-34-20-23-41-24-21-34)27-33(38)36(26-29-12-10-22-42-29)19-16-28-14-15-30(39-2)31(25-28)40-3/h10,12,14-15,22,25H,4-9,11,13,16-21,23-24,26-27H2,1-3H3 |
| InChIKey | XWXGZISRQJOKCU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|