C31H49N3O7S — CID 5172479
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(octylsulfonyl)amino]acetamide (PubChem CID 5172479) has the molecular formula C31H49N3O7S and a molecular weight of 607.81 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(octylsulfonyl)amino]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(octylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 5172479 |
| Molecular Formula | C31H49N3O7S |
| Molecular Weight | 607.81 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(octylsulfonyl)amino]acetamide |
| SMILES | CCCCCCCCS(=O)(=O)N(CCN1CCOCC1)CC(=O)N(CCc1ccc(OC)c(OC)c1)Cc1ccco1 |
| InChI | InChI=1S/C31H49N3O7S/c1-4-5-6-7-8-9-23-42(36,37)34(17-16-32-18-21-40-22-19-32)26-31(35)33(25-28-11-10-20-41-28)15-14-27-12-13-29(38-2)30(24-27)39-3/h10-13,20,24H,4-9,14-19,21-23,25-26H2,1-3H3 |
| InChIKey | ABHPTRQKSZFIOJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|