C30H45N3O4 — CID 3490337
N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide (PubChem CID 3490337) has the molecular formula C30H45N3O4 and a molecular weight of 511.71 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide.
| Compound Name | N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide |
|---|---|
| PubChem CID | 3490337 |
| Molecular Formula | C30H45N3O4 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCN1CCOCC1)CC(=O)N(CCc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C30H45N3O4/c1-2-3-4-5-6-10-15-29(34)33(19-18-31-20-23-36-24-21-31)26-30(35)32(25-28-14-11-22-37-28)17-16-27-12-8-7-9-13-27/h7-9,11-14,22H,2-6,10,15-21,23-26H2,1H3 |
| InChIKey | VPJLZUVDIVOBAB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|