C30H45N3O3S — CID 3880529
N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide (PubChem CID 3880529) has the molecular formula C30H45N3O3S and a molecular weight of 527.78 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide.
| Compound Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide |
|---|---|
| PubChem CID | 3880529 |
| Molecular Formula | C30H45N3O3S |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCN1CCOCC1)CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1 |
| InChI | InChI=1S/C30H45N3O3S/c1-3-4-5-6-7-11-14-29(34)32(18-17-31-19-21-36-22-20-31)25-30(35)33(23-27-12-9-8-10-13-27)24-28-16-15-26(2)37-28/h8-10,12-13,15-16H,3-7,11,14,17-25H2,1-2H3 |
| InChIKey | HZLXNTGZWLDYSH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|