C28H41N3O3S — CID 3897940
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)octanamide (PubChem CID 3897940) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)octanamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)octanamide |
|---|---|
| PubChem CID | 3897940 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CCN1CCOCC1)CC(=O)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C28H41N3O3S/c1-2-3-4-5-9-14-27(32)30(16-15-29-17-19-34-20-18-29)24-28(33)31(23-26-13-10-21-35-26)22-25-11-7-6-8-12-25/h6-8,10-13,21H,2-5,9,14-20,22-24H2,1H3 |
| InChIKey | LWKVMSAOOAMSDR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|