C27H38N2O4 — CID 42701783
N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-morpholin-4-ylethyl)hexanamide (PubChem CID 42701783) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-morpholin-4-ylethyl)hexanamide.
| Compound Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-morpholin-4-ylethyl)hexanamide |
|---|---|
| PubChem CID | 42701783 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-morpholin-4-ylethyl)hexanamide |
| SMILES | CCCCCC(=O)N(CCN1CCOCC1)Cc1ccc(OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H38N2O4/c1-3-4-6-11-27(30)29(15-14-28-16-18-32-19-17-28)21-24-12-13-25(31-2)26(20-24)33-22-23-9-7-5-8-10-23/h5,7-10,12-13,20H,3-4,6,11,14-19,21-22H2,1-2H3 |
| InChIKey | HORYHGCADAQNPH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|