C37H50N2O3 — CID 142128614
N-(1-benzylpiperidin-4-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]decanamide (PubChem CID 142128614) has the molecular formula C37H50N2O3 and a molecular weight of 570.82 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]decanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]decanamide |
|---|---|
| PubChem CID | 142128614 |
| Molecular Formula | C37H50N2O3 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(Cc1ccc(OCc2ccccc2)c(OC)c1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C37H50N2O3/c1-3-4-5-6-7-8-15-20-37(40)39(34-23-25-38(26-24-34)28-31-16-11-9-12-17-31)29-33-21-22-35(36(27-33)41-2)42-30-32-18-13-10-14-19-32/h9-14,16-19,21-22,27,34H,3-8,15,20,23-26,28-30H2,1-2H3 |
| InChIKey | BYWFBTRCRWPXHH-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|