C29H34N2O4 — CID 42701785
N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42701785) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42701785 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1ccc(CN(CCN2CCOCC2)C(=O)c2ccccc2C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H34N2O4/c1-23-8-6-7-11-26(23)29(32)31(15-14-30-16-18-34-19-17-30)21-25-12-13-27(33-2)28(20-25)35-22-24-9-4-3-5-10-24/h3-13,20H,14-19,21-22H2,1-2H3 |
| InChIKey | BCJSIPCAKDFLDW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |