C20H23F3N2O6S — CID 3493984
[2-methoxy-5-[[2-methoxyethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 3493984) has the molecular formula C20H23F3N2O6S and a molecular weight of 476.47 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3493984 |
| Molecular Formula | C20H23F3N2O6S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O6S/c1-29-11-10-25(19(26)24-16-7-5-4-6-15(16)20(21,22)23)13-14-8-9-17(30-2)18(12-14)31-32(3,27)28/h4-9,12H,10-11,13H2,1-3H3,(H,24,26) |
| InChIKey | PBWAEVXEZMBGAV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|