C21H20FNO6S — CID 3379948
[5-[[(4-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 3379948) has the molecular formula C21H20FNO6S and a molecular weight of 433.46 g/mol. Its IUPAC name is [5-[[(4-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(4-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 3379948 |
| Molecular Formula | C21H20FNO6S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [5-[[(4-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)c2ccc(F)cc2)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C21H20FNO6S/c1-27-19-10-5-15(12-20(19)29-30(2,25)26)13-23(14-18-4-3-11-28-18)21(24)16-6-8-17(22)9-7-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | LSQCVCHKAQFLGP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|