C24H27FN2O6S — CID 4536731
[5-[[tert-butylcarbamoyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 4536731) has the molecular formula C24H27FN2O6S and a molecular weight of 490.55 g/mol. Its IUPAC name is [5-[[tert-butylcarbamoyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[tert-butylcarbamoyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4536731 |
| Molecular Formula | C24H27FN2O6S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [5-[[tert-butylcarbamoyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)NC(C)(C)C)cc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O6S/c1-24(2,3)26-23(28)27(16-19-6-5-13-32-19)15-17-7-12-21(31-4)22(14-17)33-34(29,30)20-10-8-18(25)9-11-20/h5-14H,15-16H2,1-4H3,(H,26,28) |
| InChIKey | WEZBSEHQKVTLDL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|