C27H29F2NO5S — CID 46135313
[5-[[3,3-dimethylbutanoyl-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 46135313) has the molecular formula C27H29F2NO5S and a molecular weight of 517.59 g/mol. Its IUPAC name is [5-[[3,3-dimethylbutanoyl-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[3,3-dimethylbutanoyl-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46135313 |
| Molecular Formula | C27H29F2NO5S |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [5-[[3,3-dimethylbutanoyl-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccc(F)cc2)C(=O)CC(C)(C)C)cc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H29F2NO5S/c1-27(2,3)16-26(31)30(17-19-5-8-21(28)9-6-19)18-20-7-14-24(34-4)25(15-20)35-36(32,33)23-12-10-22(29)11-13-23/h5-15H,16-18H2,1-4H3 |
| InChIKey | XTLFYIVXZZJJNP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|