C30H26F2N2O6S — CID 46135347
[5-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135347) has the molecular formula C30H26F2N2O6S and a molecular weight of 580.61 g/mol. Its IUPAC name is [5-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [5-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135347 |
| Molecular Formula | C30H26F2N2O6S |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | [5-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccc(F)cc2)C(=O)c2ccccc2F)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C30H26F2N2O6S/c1-20(35)33-24-12-14-25(15-13-24)41(37,38)40-29-17-22(9-16-28(29)39-2)19-34(18-21-7-10-23(31)11-8-21)30(36)26-5-3-4-6-27(26)32/h3-17H,18-19H2,1-2H3,(H,33,35) |
| InChIKey | OBDALDKHABIBBV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|