C21H22N2O6S — CID 46123678
[5-[[furan-2-ylmethyl(phenylcarbamoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 46123678) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is [5-[[furan-2-ylmethyl(phenylcarbamoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[furan-2-ylmethyl(phenylcarbamoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 46123678 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [5-[[furan-2-ylmethyl(phenylcarbamoyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)Nc2ccccc2)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C21H22N2O6S/c1-27-19-11-10-16(13-20(19)29-30(2,25)26)14-23(15-18-9-6-12-28-18)21(24)22-17-7-4-3-5-8-17/h3-13H,14-15H2,1-2H3,(H,22,24) |
| InChIKey | YTFSUEQHWJRRIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|