C21H22N2O5S2 — CID 3278573
[4-[[furan-2-ylmethyl-[(4-methylsulfanylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 3278573) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl-[(4-methylsulfanylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl-[(4-methylsulfanylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3278573 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [4-[[furan-2-ylmethyl-[(4-methylsulfanylphenyl)carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CSc1ccc(NC(=O)N(Cc2ccc(OS(C)(=O)=O)cc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H22N2O5S2/c1-29-20-11-7-17(8-12-20)22-21(24)23(15-19-4-3-13-27-19)14-16-5-9-18(10-6-16)28-30(2,25)26/h3-13H,14-15H2,1-2H3,(H,22,24) |
| InChIKey | SVYRKPLZLRJSTP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|