C21H21FN2O5S — CID 4599488
[4-[[(3-fluorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4599488) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is [4-[[(3-fluorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[(3-fluorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4599488 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [4-[[(3-fluorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(Cc2ccco2)C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H21FN2O5S/c1-2-30(26,27)29-19-10-8-16(9-11-19)14-24(15-20-7-4-12-28-20)21(25)23-18-6-3-5-17(22)13-18/h3-13H,2,14-15H2,1H3,(H,23,25) |
| InChIKey | WZXFKOAEXPRLQP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|