C26H21N3O3 — CID 60577721
1-benzyl-3-[4-(2-cyanophenoxy)phenyl]-1-(furan-2-ylmethyl)urea (PubChem CID 60577721) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-benzyl-3-[4-(2-cyanophenoxy)phenyl]-1-(furan-2-ylmethyl)urea.
| Compound Name | 1-benzyl-3-[4-(2-cyanophenoxy)phenyl]-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60577721 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-benzyl-3-[4-(2-cyanophenoxy)phenyl]-1-(furan-2-ylmethyl)urea |
| SMILES | N#Cc1ccccc1Oc1ccc(NC(=O)N(Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C26H21N3O3/c27-17-21-9-4-5-11-25(21)32-23-14-12-22(13-15-23)28-26(30)29(19-24-10-6-16-31-24)18-20-7-2-1-3-8-20/h1-16H,18-19H2,(H,28,30) |
| InChIKey | LSDQLOYFBSAFPC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |