C19H19NO6S2 — CID 3959774
[5-[[furan-2-ylmethyl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 3959774) has the molecular formula C19H19NO6S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is [5-[[furan-2-ylmethyl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[furan-2-ylmethyl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 3959774 |
| Molecular Formula | C19H19NO6S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [5-[[furan-2-ylmethyl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)c2cccs2)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C19H19NO6S2/c1-24-16-8-7-14(11-17(16)26-28(2,22)23)12-20(13-15-5-3-9-25-15)19(21)18-6-4-10-27-18/h3-11H,12-13H2,1-2H3 |
| InChIKey | XKUQCPXYSKDPFZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|