C17H20ClNO6S — CID 7260573
[5-[[[(2R)-2-chloropropanoyl]-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 7260573) has the molecular formula C17H20ClNO6S and a molecular weight of 401.87 g/mol. Its IUPAC name is [5-[[[(2R)-2-chloropropanoyl]-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[[(2R)-2-chloropropanoyl]-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 7260573 |
| Molecular Formula | C17H20ClNO6S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [5-[[[(2R)-2-chloropropanoyl]-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)[C@@H](C)Cl)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C17H20ClNO6S/c1-12(18)17(20)19(11-14-5-4-8-24-14)10-13-6-7-15(23-2)16(9-13)25-26(3,21)22/h4-9,12H,10-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | NKTMUCXHOAIFHB-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|