C20H25NO6S — CID 3683870
[4-[[2-methoxyethyl-(2-phenylmethoxyacetyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3683870) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is [4-[[2-methoxyethyl-(2-phenylmethoxyacetyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[2-methoxyethyl-(2-phenylmethoxyacetyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3683870 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-[[2-methoxyethyl-(2-phenylmethoxyacetyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C20H25NO6S/c1-25-13-12-21(20(22)16-26-15-18-6-4-3-5-7-18)14-17-8-10-19(11-9-17)27-28(2,23)24/h3-11H,12-16H2,1-2H3 |
| InChIKey | CRVUNTIXEDFBJB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|