About 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea
1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea (PubChem CID 130871132) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea |
| PubChem CID | 130871132 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cc(OC)ns1 |
| InChI | InChI=1S/C7H11N3O2S/c1-8-7(11)9-4-5-3-6(12-2)10-13-5/h3H,4H2,1-2H3,(H2,8,9,11) |
| InChIKey | SMXQJDLUUAIYGL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea?
The IUPAC name of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea (CID 130871132) is 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea.
What is the SMILES notation for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea?
The canonical SMILES for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea is CNC(=O)NCc1cc(OC)ns1.
What is the InChIKey of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea?
The InChIKey is SMXQJDLUUAIYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-8-7(11)9-4-5-3-6(12-2)10-13-5/h3H,4H2,1-2H3,(H2,8,9,11).
What are the key properties of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea?
1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea has a molecular weight of 201.25 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylurea is sourced from PubChem (CID 130871132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).