C8H12N4O — CID 102952969
6-methoxy-N,N-dimethylpyrimidine-4-carboximidamide (PubChem CID 102952969) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 6-methoxy-N,N-dimethylpyrimidine-4-carboximidamide.
| Compound Name | 6-methoxy-N,N-dimethylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 102952969 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 6-methoxy-N,N-dimethylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(/c1cc(OC)ncn1)N(C)C |
| InChI | InChI=1S/C8H12N4O/c1-12(2)8(9)6-4-7(13-3)11-5-10-6/h4-5,9H,1-3H3/b9-8- |
| InChIKey | QSMJCOXSUQJACX-HJWRWDBZSA-N |
| XLogP | 0.37 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|