C15H16F2O4 — CID 60964343
6-[(2,6-difluoro-4-methoxyphenyl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 60964343) has the molecular formula C15H16F2O4 and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-[(2,6-difluoro-4-methoxyphenyl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(2,6-difluoro-4-methoxyphenyl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 60964343 |
| Molecular Formula | C15H16F2O4 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 6-[(2,6-difluoro-4-methoxyphenyl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1cc(F)c(C(O)C2CC=CCC2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H16F2O4/c1-21-8-6-11(16)13(12(17)7-8)14(18)9-4-2-3-5-10(9)15(19)20/h2-3,6-7,9-10,14,18H,4-5H2,1H3,(H,19,20) |
| InChIKey | SMKIHZIIRNGOKG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|