C12H14O3S — CID 43120546
6-[hydroxy(thiophen-2-yl)methyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 43120546) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 6-[hydroxy(thiophen-2-yl)methyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[hydroxy(thiophen-2-yl)methyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 43120546 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6-[hydroxy(thiophen-2-yl)methyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(O)c1cccs1 |
| InChI | InChI=1S/C12H14O3S/c13-11(10-6-3-7-16-10)8-4-1-2-5-9(8)12(14)15/h1-3,6-9,11,13H,4-5H2,(H,14,15) |
| InChIKey | BZUAEAYNHWOMSJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|