C14H16ClNO3 — CID 123686628
6-[(4-chloroanilino)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 123686628) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6-[(4-chloroanilino)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(4-chloroanilino)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 123686628 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-[(4-chloroanilino)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO3/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(18)19/h1-2,5-8,11-13,16-17H,3-4H2,(H,18,19) |
| InChIKey | RSOWSDSMQUCFHK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|