C12H12Br2O3S — CID 43345088
6-[(2,5-dibromothiophen-3-yl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 43345088) has the molecular formula C12H12Br2O3S and a molecular weight of 396.10 g/mol. Its IUPAC name is 6-[(2,5-dibromothiophen-3-yl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(2,5-dibromothiophen-3-yl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 43345088 |
| Molecular Formula | C12H12Br2O3S |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 393.89 |
| IUPAC Name | 6-[(2,5-dibromothiophen-3-yl)-hydroxymethyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H12Br2O3S/c13-9-5-8(11(14)18-9)10(15)6-3-1-2-4-7(6)12(16)17/h1-2,5-7,10,15H,3-4H2,(H,16,17) |
| InChIKey | OSDCKBZJBAGIQN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|