C12H16Br2OS — CID 107969704
(2,5-dibromothiophen-3-yl)-(3-methylcyclohexyl)methanol (PubChem CID 107969704) has the molecular formula C12H16Br2OS and a molecular weight of 368.13 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(3-methylcyclohexyl)methanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-(3-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107969704 |
| Molecular Formula | C12H16Br2OS |
| Molecular Weight | 368.13 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(3-methylcyclohexyl)methanol |
| SMILES | CC1CCCC(C(O)c2cc(Br)sc2Br)C1 |
| InChI | InChI=1S/C12H16Br2OS/c1-7-3-2-4-8(5-7)11(15)9-6-10(13)16-12(9)14/h6-8,11,15H,2-5H2,1H3 |
| InChIKey | KDEZWBCSNCEUSG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.13 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |