C14H18Cl2O — CID 55187547
(3,4-dichlorophenyl)-(3-methylcyclohexyl)methanol (PubChem CID 55187547) has the molecular formula C14H18Cl2O and a molecular weight of 273.20 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 55187547 |
| Molecular Formula | C14H18Cl2O |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanol |
| SMILES | CC1CCCC(C(O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18Cl2O/c1-9-3-2-4-10(7-9)14(17)11-5-6-12(15)13(16)8-11/h5-6,8-10,14,17H,2-4,7H2,1H3 |
| InChIKey | OFUJQUNMOURMTG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |