C14H19Cl2N — CID 55185865
(3,4-dichlorophenyl)-(3-methylcyclohexyl)methanamine (PubChem CID 55185865) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanamine.
| Compound Name | (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 55185865 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (3,4-dichlorophenyl)-(3-methylcyclohexyl)methanamine |
| SMILES | CC1CCCC(C(N)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H19Cl2N/c1-9-3-2-4-10(7-9)14(17)11-5-6-12(15)13(16)8-11/h5-6,8-10,14H,2-4,7,17H2,1H3 |
| InChIKey | KZMXAAXVYYGAKW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |