About 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid
2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid (PubChem CID 114392572) has the molecular formula C16H21BrO3
and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid |
| PubChem CID | 114392572 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid |
| SMILES | Cc1cc(C(O)C2CC(C)CC2C(=O)O)c(C)cc1Br |
| InChI | InChI=1S/C16H21BrO3/c1-8-4-12(13(5-8)16(19)20)15(18)11-6-10(3)14(17)7-9(11)2/h6-8,12-13,15,18H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | YJQSYHDNVROENR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid?
The IUPAC name of 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid (CID 114392572) is 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid?
The canonical SMILES for 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid is Cc1cc(C(O)C2CC(C)CC2C(=O)O)c(C)cc1Br.
What is the InChIKey of 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid?
The InChIKey is YJQSYHDNVROENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrO3/c1-8-4-12(13(5-8)16(19)20)15(18)11-6-10(3)14(17)7-9(11)2/h6-8,12-13,15,18H,4-5H2,1-3H3,(H,19,20).
What are the key properties of 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid?
2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid has a molecular weight of 341.25 g/mol, XLogP of 3.85, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2,5-dimethylphenyl)-hydroxymethyl]-4-methylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 114392572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).